C22H26N2O4 — CID 23615136
(4S)-4-benzyl-3-[(2S,3S)-3-[4-(dimethylamino)phenyl]-3-hydroxy-2-methylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 23615136) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3S)-3-[4-(dimethylamino)phenyl]-3-hydroxy-2-methylpropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3S)-3-[4-(dimethylamino)phenyl]-3-hydroxy-2-methylpropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23615136 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3S)-3-[4-(dimethylamino)phenyl]-3-hydroxy-2-methylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-15(20(25)17-9-11-18(12-10-17)23(2)3)21(26)24-19(14-28-22(24)27)13-16-7-5-4-6-8-16/h4-12,15,19-20,25H,13-14H2,1-3H3/t15-,19-,20-/m0/s1 |
| InChIKey | MKXXJJUBQRBHSJ-YSSFQJQWSA-N |
| XLogP | 3.01 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|