About 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate
5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 23615184) has the molecular formula C7H7O4-
and a molecular weight of 155.13 g/mol. Its IUPAC name is 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 23615184 |
| Molecular Formula | C7H7O4- |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | O=C([O-])C1=CC=CC(O)C1O |
| InChI | InChI=1S/C7H8O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,5-6,8-9H,(H,10,11)/p-1 |
| InChIKey | INCSWYKICIYAHB-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate (CID 23615184) is 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate is O=C([O-])C1=CC=CC(O)C1O.
What is the InChIKey of 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
The InChIKey is INCSWYKICIYAHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,5-6,8-9H,(H,10,11)/p-1.
What are the key properties of 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate?
5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate has a molecular weight of 155.13 g/mol, XLogP of -2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 23615184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).