About 2-oxohexanedioate
2-oxohexanedioate (PubChem CID 23615192) has the molecular formula C6H6O5-2
and a molecular weight of 158.11 g/mol. Its IUPAC name is 2-oxohexanedioate.
Molecular Properties
| Compound Name | 2-oxohexanedioate |
| PubChem CID | 23615192 |
| Molecular Formula | C6H6O5-2 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 2-oxohexanedioate |
| SMILES | O=C([O-])CCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2 |
| InChIKey | FGSBNBBHOZHUBO-UHFFFAOYSA-L |
| XLogP | -2.77 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxohexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxohexanedioate?
The IUPAC name of 2-oxohexanedioate (CID 23615192) is 2-oxohexanedioate.
What is the SMILES notation for 2-oxohexanedioate?
The canonical SMILES for 2-oxohexanedioate is O=C([O-])CCCC(=O)C(=O)[O-].
What is the InChIKey of 2-oxohexanedioate?
The InChIKey is FGSBNBBHOZHUBO-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H8O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3H2,(H,8,9)(H,10,11)/p-2.
What are the key properties of 2-oxohexanedioate?
2-oxohexanedioate has a molecular weight of 158.11 g/mol, XLogP of -2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxohexanedioate is sourced from PubChem (CID 23615192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).