About 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate
7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate (PubChem CID 23615703) has the molecular formula C8H12O6
and a molecular weight of 204.18 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate.
Molecular Properties
| Compound Name | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate |
| PubChem CID | 23615703 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate |
| SMILES | O.O=C(O)C1C2CCC(O2)C1C(=O)O |
| InChI | InChI=1S/C8H10O5.H2O/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;/h3-6H,1-2H2,(H,9,10)(H,11,12);1H2 |
| InChIKey | RHLALKDQINFLPM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate?
The IUPAC name of 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate (CID 23615703) is 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate.
What is the SMILES notation for 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate?
The canonical SMILES for 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate is O.O=C(O)C1C2CCC(O2)C1C(=O)O.
What is the InChIKey of 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate?
The InChIKey is RHLALKDQINFLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5.H2O/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;/h3-6H,1-2H2,(H,9,10)(H,11,12);1H2.
What are the key properties of 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate?
7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate has a molecular weight of 204.18 g/mol, XLogP of -0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid;hydrate is sourced from PubChem (CID 23615703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).