About 1,5-dichloropentan-3-amine;hydrochloride
1,5-dichloropentan-3-amine;hydrochloride (PubChem CID 23615808) has the molecular formula C5H12Cl3N
and a molecular weight of 192.52 g/mol. Its IUPAC name is 1,5-dichloropentan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dichloropentan-3-amine;hydrochloride |
| PubChem CID | 23615808 |
| Molecular Formula | C5H12Cl3N |
| Molecular Weight | 192.52 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | 1,5-dichloropentan-3-amine;hydrochloride |
| SMILES | Cl.NC(CCCl)CCCl |
| InChI | InChI=1S/C5H11Cl2N.ClH/c6-3-1-5(8)2-4-7;/h5H,1-4,8H2;1H |
| InChIKey | XSAZHBQBSMVOBA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dichloropentan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloropentan-3-amine;hydrochloride?
The IUPAC name of 1,5-dichloropentan-3-amine;hydrochloride (CID 23615808) is 1,5-dichloropentan-3-amine;hydrochloride.
What is the SMILES notation for 1,5-dichloropentan-3-amine;hydrochloride?
The canonical SMILES for 1,5-dichloropentan-3-amine;hydrochloride is Cl.NC(CCCl)CCCl.
What is the InChIKey of 1,5-dichloropentan-3-amine;hydrochloride?
The InChIKey is XSAZHBQBSMVOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Cl2N.ClH/c6-3-1-5(8)2-4-7;/h5H,1-4,8H2;1H.
What are the key properties of 1,5-dichloropentan-3-amine;hydrochloride?
1,5-dichloropentan-3-amine;hydrochloride has a molecular weight of 192.52 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloropentan-3-amine;hydrochloride is sourced from PubChem (CID 23615808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).