About sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide
sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 23616379) has the molecular formula C10H12N4NaO2S2+
and a molecular weight of 307.36 g/mol. Its IUPAC name is sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| PubChem CID | 23616379 |
| Molecular Formula | C10H12N4NaO2S2+ |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1.[Na+] |
| InChI | InChI=1S/C10H12N4O2S2.Na/c1-2-9-12-13-10(17-9)14-18(15,16)8-5-3-7(11)4-6-8;/h3-6H,2,11H2,1H3,(H,13,14);/q;+1 |
| InChIKey | RDBXEDPTJIKNAB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The IUPAC name of sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (CID 23616379) is sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The canonical SMILES for sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide is CCc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1.[Na+].
What is the InChIKey of sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The InChIKey is RDBXEDPTJIKNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2S2.Na/c1-2-9-12-13-10(17-9)14-18(15,16)8-5-3-7(11)4-6-8;/h3-6H,2,11H2,1H3,(H,13,14);/q;+1.
What are the key properties of sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide has a molecular weight of 307.36 g/mol, XLogP of -1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 23616379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).