About 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol (PubChem CID 23616517) has the molecular formula C21H30O5
and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol.
Molecular Properties
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol |
| PubChem CID | 23616517 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(O)COCC(C)O |
| InChI | InChI=1S/C15H16O2.C6H14O3/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-5(7)3-9-4-6(2)8/h3-10,16-17H,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | IAKBDONNFRRGRG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol?
The IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol (CID 23616517) is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol.
What is the SMILES notation for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol?
The canonical SMILES for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol is CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(O)COCC(C)O.
What is the InChIKey of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol?
The InChIKey is IAKBDONNFRRGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C6H14O3/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-5(7)3-9-4-6(2)8/h3-10,16-17H,1-2H3;5-8H,3-4H2,1-2H3.
What are the key properties of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol?
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol has a molecular weight of 362.47 g/mol, XLogP of 3.19, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;1-(2-hydroxypropoxy)propan-2-ol is sourced from PubChem (CID 23616517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).