About 1,2,3-trinitrotriazinane
1,2,3-trinitrotriazinane (PubChem CID 23616558) has the molecular formula C3H6N6O6
and a molecular weight of 222.12 g/mol. Its IUPAC name is 1,2,3-trinitrotriazinane.
Molecular Properties
| Compound Name | 1,2,3-trinitrotriazinane |
| PubChem CID | 23616558 |
| Molecular Formula | C3H6N6O6 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 1,2,3-trinitrotriazinane |
| SMILES | O=[N+]([O-])N1CCCN([N+](=O)[O-])N1[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N6O6/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h1-3H2 |
| InChIKey | WYQWUSFGZRLLBP-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 139.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trinitrotriazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trinitrotriazinane?
The IUPAC name of 1,2,3-trinitrotriazinane (CID 23616558) is 1,2,3-trinitrotriazinane.
What is the SMILES notation for 1,2,3-trinitrotriazinane?
The canonical SMILES for 1,2,3-trinitrotriazinane is O=[N+]([O-])N1CCCN([N+](=O)[O-])N1[N+](=O)[O-].
What is the InChIKey of 1,2,3-trinitrotriazinane?
The InChIKey is WYQWUSFGZRLLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N6O6/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h1-3H2.
What are the key properties of 1,2,3-trinitrotriazinane?
1,2,3-trinitrotriazinane has a molecular weight of 222.12 g/mol, XLogP of -1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trinitrotriazinane is sourced from PubChem (CID 23616558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).