About 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid
1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 23616842) has the molecular formula C19H21Cl2NO5S
and a molecular weight of 446.35 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| PubChem CID | 23616842 |
| Molecular Formula | C19H21Cl2NO5S |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1.O=C(CCl)CCl |
| InChI | InChI=1S/C16H17NO4S.C3H4Cl2O/c1-12-7-9-14(10-8-12)22(20,21)17-15(16(18)19)11-13-5-3-2-4-6-13;4-1-3(6)2-5/h2-10,15,17H,11H2,1H3,(H,18,19);1-2H2/t15-;/m0./s1 |
| InChIKey | MXXVXUKTFUBSKJ-RSAXXLAASA-N |
| XLogP | 3.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid?
The IUPAC name of 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid (CID 23616842) is 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid.
What is the SMILES notation for 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid?
The canonical SMILES for 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid is Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1.O=C(CCl)CCl.
What is the InChIKey of 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid?
The InChIKey is MXXVXUKTFUBSKJ-RSAXXLAASA-N. The full InChI is InChI=1S/C16H17NO4S.C3H4Cl2O/c1-12-7-9-14(10-8-12)22(20,21)17-15(16(18)19)11-13-5-3-2-4-6-13;4-1-3(6)2-5/h2-10,15,17H,11H2,1H3,(H,18,19);1-2H2/t15-;/m0./s1.
What are the key properties of 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid?
1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid has a molecular weight of 446.35 g/mol, XLogP of 3.00, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloropropan-2-one;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid is sourced from PubChem (CID 23616842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).