About 2-acetylbenzenesulfonyl fluoride
2-acetylbenzenesulfonyl fluoride (PubChem CID 23617229) has the molecular formula C8H7FO3S
and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-acetylbenzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 2-acetylbenzenesulfonyl fluoride |
| PubChem CID | 23617229 |
| Molecular Formula | C8H7FO3S |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 2-acetylbenzenesulfonyl fluoride |
| SMILES | CC(=O)c1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C8H7FO3S/c1-6(10)7-4-2-3-5-8(7)13(9,11)12/h2-5H,1H3 |
| InChIKey | WZIRCNRSHAORQS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-acetylbenzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylbenzenesulfonyl fluoride?
The IUPAC name of 2-acetylbenzenesulfonyl fluoride (CID 23617229) is 2-acetylbenzenesulfonyl fluoride.
What is the SMILES notation for 2-acetylbenzenesulfonyl fluoride?
The canonical SMILES for 2-acetylbenzenesulfonyl fluoride is CC(=O)c1ccccc1S(=O)(=O)F.
What is the InChIKey of 2-acetylbenzenesulfonyl fluoride?
The InChIKey is WZIRCNRSHAORQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO3S/c1-6(10)7-4-2-3-5-8(7)13(9,11)12/h2-5H,1H3.
What are the key properties of 2-acetylbenzenesulfonyl fluoride?
2-acetylbenzenesulfonyl fluoride has a molecular weight of 202.21 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylbenzenesulfonyl fluoride is sourced from PubChem (CID 23617229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).