C8H8Cl4O2 — CID 23617318
1,3,5,6-tetrachloro-2,5-dimethoxycyclohexa-1,3-diene (PubChem CID 23617318) has the molecular formula C8H8Cl4O2 and a molecular weight of 277.96 g/mol. Its IUPAC name is 1,3,5,6-tetrachloro-2,5-dimethoxycyclohexa-1,3-diene.
| Compound Name | 1,3,5,6-tetrachloro-2,5-dimethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 23617318 |
| Molecular Formula | C8H8Cl4O2 |
| Molecular Weight | 277.96 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | 1,3,5,6-tetrachloro-2,5-dimethoxycyclohexa-1,3-diene |
| SMILES | COC1=C(Cl)C(Cl)C(Cl)(OC)C=C1Cl |
| InChI | InChI=1S/C8H8Cl4O2/c1-13-6-4(9)3-8(12,14-2)7(11)5(6)10/h3,7H,1-2H3 |
| InChIKey | VOPGYWNBSBKGGO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.96 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|