About 1-methoxyethyl carbamate
1-methoxyethyl carbamate (PubChem CID 23617543) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 1-methoxyethyl carbamate.
Molecular Properties
| Compound Name | 1-methoxyethyl carbamate |
| PubChem CID | 23617543 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 1-methoxyethyl carbamate |
| SMILES | COC(C)OC(N)=O |
| InChI | InChI=1S/C4H9NO3/c1-3(7-2)8-4(5)6/h3H,1-2H3,(H2,5,6) |
| InChIKey | JXBPDJIBFPFVSY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl carbamate?
The IUPAC name of 1-methoxyethyl carbamate (CID 23617543) is 1-methoxyethyl carbamate.
What is the SMILES notation for 1-methoxyethyl carbamate?
The canonical SMILES for 1-methoxyethyl carbamate is COC(C)OC(N)=O.
What is the InChIKey of 1-methoxyethyl carbamate?
The InChIKey is JXBPDJIBFPFVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c1-3(7-2)8-4(5)6/h3H,1-2H3,(H2,5,6).
What are the key properties of 1-methoxyethyl carbamate?
1-methoxyethyl carbamate has a molecular weight of 119.12 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl carbamate is sourced from PubChem (CID 23617543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).