About 1-nitroethylbenzene
1-nitroethylbenzene (PubChem CID 23618) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 1-nitroethylbenzene.
Molecular Properties
| Compound Name | 1-nitroethylbenzene |
| PubChem CID | 23618 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1-nitroethylbenzene |
| SMILES | CC(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H9NO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | GJOVHPKYFFGKCY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroethylbenzene?
The IUPAC name of 1-nitroethylbenzene (CID 23618) is 1-nitroethylbenzene.
What is the SMILES notation for 1-nitroethylbenzene?
The canonical SMILES for 1-nitroethylbenzene is CC(c1ccccc1)[N+](=O)[O-].
What is the InChIKey of 1-nitroethylbenzene?
The InChIKey is GJOVHPKYFFGKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-nitroethylbenzene?
1-nitroethylbenzene has a molecular weight of 151.16 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroethylbenzene is sourced from PubChem (CID 23618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).