About [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate
[(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate (PubChem CID 2361800) has the molecular formula C12H11NO6
and a molecular weight of 265.22 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate |
| PubChem CID | 2361800 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)O[C@@H]2CCOC2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11NO6/c1-7-8(3-2-4-9(7)13(16)17)11(14)19-10-5-6-18-12(10)15/h2-4,10H,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | QRCCEYWLTVPGTP-SNVBAGLBSA-N |
| XLogP | 1.38 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate?
The IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate (CID 2361800) is [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate.
What is the SMILES notation for [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate?
The canonical SMILES for [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate is Cc1c(C(=O)O[C@@H]2CCOC2=O)cccc1[N+](=O)[O-].
What is the InChIKey of [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate?
The InChIKey is QRCCEYWLTVPGTP-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H11NO6/c1-7-8(3-2-4-9(7)13(16)17)11(14)19-10-5-6-18-12(10)15/h2-4,10H,5-6H2,1H3/t10-/m1/s1.
What are the key properties of [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate?
[(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate has a molecular weight of 265.22 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxooxolan-3-yl] 2-methyl-3-nitrobenzoate is sourced from PubChem (CID 2361800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).