C19H28O2 — CID 23618146
(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,13-dimethyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one (PubChem CID 23618146) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,13-dimethyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one.
| Compound Name | (7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,13-dimethyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 23618146 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,13-dimethyl-3,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one |
| SMILES | C[C@@H]1CC2=CCCC(=O)[C@@H]2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C19H28O2/c1-11-10-12-4-3-5-15(20)18(12)13-8-9-19(2)14(17(11)13)6-7-16(19)21/h4,11,13-14,16-18,21H,3,5-10H2,1-2H3/t11-,13+,14+,16+,17-,18+,19+/m1/s1 |
| InChIKey | RMYUMZHLOHTMCD-VVJIVDIYSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|