About disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate
disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate (PubChem CID 23618870) has the molecular formula C18H21NNa2O7
and a molecular weight of 409.35 g/mol. Its IUPAC name is disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate.
Molecular Properties
| Compound Name | disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate |
| PubChem CID | 23618870 |
| Molecular Formula | C18H21NNa2O7 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate |
| SMILES | CC(C)OC(=O)Nc1ccccc1.O=C([O-])C1C2CCC(O2)C1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H13NO2.C8H10O5.2Na/c1-8(2)13-10(12)11-9-6-4-3-5-7-9;9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-8H,1-2H3,(H,11,12);3-6H,1-2H2,(H,9,10)(H,11,12);;/q;;2*+1/p-2 |
| InChIKey | YVEARADXBHTRPH-UHFFFAOYSA-L |
| XLogP | -6.07 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | -6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate?
The IUPAC name of disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate (CID 23618870) is disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate.
What is the SMILES notation for disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate?
The canonical SMILES for disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate is CC(C)OC(=O)Nc1ccccc1.O=C([O-])C1C2CCC(O2)C1C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate?
The InChIKey is YVEARADXBHTRPH-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H13NO2.C8H10O5.2Na/c1-8(2)13-10(12)11-9-6-4-3-5-7-9;9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-8H,1-2H3,(H,11,12);3-6H,1-2H2,(H,9,10)(H,11,12);;/q;;2*+1/p-2.
What are the key properties of disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate?
disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate has a molecular weight of 409.35 g/mol, XLogP of -6.07, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate;propan-2-yl N-phenylcarbamate is sourced from PubChem (CID 23618870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).