About mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid
mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid (PubChem CID 23618876) has the molecular formula C9H16HgN2O5+2
and a molecular weight of 432.83 g/mol. Its IUPAC name is mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid |
| PubChem CID | 23618876 |
| Molecular Formula | C9H16HgN2O5+2 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid |
| SMILES | COC(C)CNC(=O)NC(=O)CCC(=O)O.[Hg+2] |
| InChI | InChI=1S/C9H16N2O5.Hg/c1-6(16-2)5-10-9(15)11-7(12)3-4-8(13)14;/h6H,3-5H2,1-2H3,(H,13,14)(H2,10,11,12,15);/q;+2 |
| InChIKey | HBXHKJWGESUYLX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid?
The IUPAC name of mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid (CID 23618876) is mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid.
What is the SMILES notation for mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid?
The canonical SMILES for mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid is COC(C)CNC(=O)NC(=O)CCC(=O)O.[Hg+2].
What is the InChIKey of mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid?
The InChIKey is HBXHKJWGESUYLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O5.Hg/c1-6(16-2)5-10-9(15)11-7(12)3-4-8(13)14;/h6H,3-5H2,1-2H3,(H,13,14)(H2,10,11,12,15);/q;+2.
What are the key properties of mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid?
mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid has a molecular weight of 432.83 g/mol, XLogP of -0.29, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(2+);4-(2-methoxypropylcarbamoylamino)-4-oxobutanoic acid is sourced from PubChem (CID 23618876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).