C10H14N2O5 — CID 23619088
methylcarbamic acid;methyl N-(3-hydroxyphenyl)carbamate (PubChem CID 23619088) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is methylcarbamic acid;methyl N-(3-hydroxyphenyl)carbamate.
| Compound Name | methylcarbamic acid;methyl N-(3-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 23619088 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | methylcarbamic acid;methyl N-(3-hydroxyphenyl)carbamate |
| SMILES | CNC(=O)O.COC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C8H9NO3.C2H5NO2/c1-12-8(11)9-6-3-2-4-7(10)5-6;1-3-2(4)5/h2-5,10H,1H3,(H,9,11);3H,1H3,(H,4,5) |
| InChIKey | ABKAVDOCKWZTEP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |