About thorium(2+) dinitrate
thorium(2+) dinitrate (PubChem CID 23619112) has the molecular formula N2O6Th
and a molecular weight of 356.05 g/mol. Its IUPAC name is thorium(2+) dinitrate.
Molecular Properties
| Compound Name | thorium(2+) dinitrate |
| PubChem CID | 23619112 |
| Molecular Formula | N2O6Th |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | thorium(2+) dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Th+2] |
| InChI | InChI=1S/2NO3.Th/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | MOADARWLQNRFRL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 132.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thorium(2+) dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thorium(2+) dinitrate?
The IUPAC name of thorium(2+) dinitrate (CID 23619112) is thorium(2+) dinitrate.
What is the SMILES notation for thorium(2+) dinitrate?
The canonical SMILES for thorium(2+) dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Th+2].
What is the InChIKey of thorium(2+) dinitrate?
The InChIKey is MOADARWLQNRFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/2NO3.Th/c2*2-1(3)4;/q2*-1;+2.
What are the key properties of thorium(2+) dinitrate?
thorium(2+) dinitrate has a molecular weight of 356.05 g/mol, XLogP of -0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thorium(2+) dinitrate is sourced from PubChem (CID 23619112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).