About 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene
1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene (PubChem CID 23619703) has the molecular formula C13H10BrCl2O3PS
and a molecular weight of 428.07 g/mol. Its IUPAC name is 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene.
Molecular Properties
| Compound Name | 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene |
| PubChem CID | 23619703 |
| Molecular Formula | C13H10BrCl2O3PS |
| Molecular Weight | 428.07 g/mol |
| Exact Mass | 425.86 |
| IUPAC Name | 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene |
| SMILES | COP(=O)(Oc1cc(Cl)c(Br)cc1Cl)Sc1ccccc1 |
| InChI | InChI=1S/C13H10BrCl2O3PS/c1-18-20(17,21-9-5-3-2-4-6-9)19-13-8-11(15)10(14)7-12(13)16/h2-8H,1H3 |
| InChIKey | CTVDZBPXRCTICL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.07 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene?
The IUPAC name of 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene (CID 23619703) is 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene.
What is the SMILES notation for 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene?
The canonical SMILES for 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene is COP(=O)(Oc1cc(Cl)c(Br)cc1Cl)Sc1ccccc1.
What is the InChIKey of 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene?
The InChIKey is CTVDZBPXRCTICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrCl2O3PS/c1-18-20(17,21-9-5-3-2-4-6-9)19-13-8-11(15)10(14)7-12(13)16/h2-8H,1H3.
What are the key properties of 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene?
1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene has a molecular weight of 428.07 g/mol, XLogP of 6.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,5-dichloro-4-[methoxy(phenylsulfanyl)phosphoryl]oxybenzene is sourced from PubChem (CID 23619703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).