About (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium
(3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium (PubChem CID 23620073) has the molecular formula C12H18NO2+
and a molecular weight of 208.28 g/mol. Its IUPAC name is (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium.
Molecular Properties
| Compound Name | (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium |
| PubChem CID | 23620073 |
| Molecular Formula | C12H18NO2+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium |
| SMILES | CC1Oc2c(cccc2[N+](C)(C)C)C1O |
| InChI | InChI=1S/C12H18NO2/c1-8-11(14)9-6-5-7-10(12(9)15-8)13(2,3)4/h5-8,11,14H,1-4H3/q+1 |
| InChIKey | ORDVPWGKZPGLMB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium?
The IUPAC name of (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium (CID 23620073) is (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium.
What is the SMILES notation for (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium?
The canonical SMILES for (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium is CC1Oc2c(cccc2[N+](C)(C)C)C1O.
What is the InChIKey of (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium?
The InChIKey is ORDVPWGKZPGLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18NO2/c1-8-11(14)9-6-5-7-10(12(9)15-8)13(2,3)4/h5-8,11,14H,1-4H3/q+1.
What are the key properties of (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium?
(3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium has a molecular weight of 208.28 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)-trimethylazanium is sourced from PubChem (CID 23620073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).