C12H21N2O3+ — CID 23620142
5-butyl-1-ethyl-1,3-dimethyl-1,3-diazinan-1-ium-2,4,6-trione (PubChem CID 23620142) has the molecular formula C12H21N2O3+ and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-butyl-1-ethyl-1,3-dimethyl-1,3-diazinan-1-ium-2,4,6-trione.
| Compound Name | 5-butyl-1-ethyl-1,3-dimethyl-1,3-diazinan-1-ium-2,4,6-trione |
|---|---|
| PubChem CID | 23620142 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 5-butyl-1-ethyl-1,3-dimethyl-1,3-diazinan-1-ium-2,4,6-trione |
| SMILES | CCCCC1C(=O)N(C)C(=O)[N+](C)(CC)C1=O |
| InChI | InChI=1S/C12H21N2O3/c1-5-7-8-9-10(15)13(3)12(17)14(4,6-2)11(9)16/h9H,5-8H2,1-4H3/q+1 |
| InChIKey | WEWSBVYYGFNYMB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|