C14H27N3O6S-2 — CID 23622619
N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide sulfate (PubChem CID 23622619) has the molecular formula C14H27N3O6S-2 and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide sulfate.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide sulfate |
|---|---|
| PubChem CID | 23622619 |
| Molecular Formula | C14H27N3O6S-2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide sulfate |
| SMILES | CC(C)N(CCNC(=O)CN1CCCC1=O)C(C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C14H27N3O2.H2O4S/c1-11(2)17(12(3)4)9-7-15-13(18)10-16-8-5-6-14(16)19;1-5(2,3)4/h11-12H,5-10H2,1-4H3,(H,15,18);(H2,1,2,3,4)/p-2 |
| InChIKey | ACSROKXFXFNERX-UHFFFAOYSA-L |
| XLogP | -0.49 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|