C16H24Cl2N2O2 — CID 23623376
N-[2-[1-[bis(2-chloroethyl)amino]ethyl]phenyl]-2-ethoxyacetamide (PubChem CID 23623376) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is N-[2-[1-[bis(2-chloroethyl)amino]ethyl]phenyl]-2-ethoxyacetamide.
| Compound Name | N-[2-[1-[bis(2-chloroethyl)amino]ethyl]phenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 23623376 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[2-[1-[bis(2-chloroethyl)amino]ethyl]phenyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)Nc1ccccc1C(C)N(CCCl)CCCl |
| InChI | InChI=1S/C16H24Cl2N2O2/c1-3-22-12-16(21)19-15-7-5-4-6-14(15)13(2)20(10-8-17)11-9-18/h4-7,13H,3,8-12H2,1-2H3,(H,19,21) |
| InChIKey | CSHRMVWQISWYEW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|