C21H22O5 — CID 23624577
methyl 6-benzoyloxy-2,5,8-trimethyl-3,4-dihydrochromene-2-carboxylate (PubChem CID 23624577) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl 6-benzoyloxy-2,5,8-trimethyl-3,4-dihydrochromene-2-carboxylate.
| Compound Name | methyl 6-benzoyloxy-2,5,8-trimethyl-3,4-dihydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 23624577 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | methyl 6-benzoyloxy-2,5,8-trimethyl-3,4-dihydrochromene-2-carboxylate |
| SMILES | COC(=O)C1(C)CCc2c(C)c(OC(=O)c3ccccc3)cc(C)c2O1 |
| InChI | InChI=1S/C21H22O5/c1-13-12-17(25-19(22)15-8-6-5-7-9-15)14(2)16-10-11-21(3,20(23)24-4)26-18(13)16/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | LHADQVUJMAHGAJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|