About oxiran-2-ylmethyl (Z)-hexadec-9-enoate
oxiran-2-ylmethyl (Z)-hexadec-9-enoate (PubChem CID 23624909) has the molecular formula C19H34O3
and a molecular weight of 310.48 g/mol. Its IUPAC name is oxiran-2-ylmethyl (Z)-hexadec-9-enoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl (Z)-hexadec-9-enoate |
| PubChem CID | 23624909 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | oxiran-2-ylmethyl (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC1CO1 |
| InChI | InChI=1S/C19H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h7-8,18H,2-6,9-17H2,1H3/b8-7- |
| InChIKey | FWEHVPCBXKCYHE-FPLPWBNLSA-N |
| XLogP | 5.19 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl (Z)-hexadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl (Z)-hexadec-9-enoate?
The IUPAC name of oxiran-2-ylmethyl (Z)-hexadec-9-enoate (CID 23624909) is oxiran-2-ylmethyl (Z)-hexadec-9-enoate.
What is the SMILES notation for oxiran-2-ylmethyl (Z)-hexadec-9-enoate?
The canonical SMILES for oxiran-2-ylmethyl (Z)-hexadec-9-enoate is CCCCCC/C=C\CCCCCCCC(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl (Z)-hexadec-9-enoate?
The InChIKey is FWEHVPCBXKCYHE-FPLPWBNLSA-N. The full InChI is InChI=1S/C19H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h7-8,18H,2-6,9-17H2,1H3/b8-7-.
What are the key properties of oxiran-2-ylmethyl (Z)-hexadec-9-enoate?
oxiran-2-ylmethyl (Z)-hexadec-9-enoate has a molecular weight of 310.48 g/mol, XLogP of 5.19, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl (Z)-hexadec-9-enoate is sourced from PubChem (CID 23624909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).