C17H23BrN2OSi — CID 23624954
(1S,3aS,8bS)-6-bromo-3-methyl-8b-prop-2-enyl-1-trimethylsilyl-3a,4-dihydro-1H-pyrrolo[2,3-b]indol-2-one (PubChem CID 23624954) has the molecular formula C17H23BrN2OSi and a molecular weight of 379.37 g/mol. Its IUPAC name is (1S,3aS,8bS)-6-bromo-3-methyl-8b-prop-2-enyl-1-trimethylsilyl-3a,4-dihydro-1H-pyrrolo[2,3-b]indol-2-one.
| Compound Name | (1S,3aS,8bS)-6-bromo-3-methyl-8b-prop-2-enyl-1-trimethylsilyl-3a,4-dihydro-1H-pyrrolo[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 23624954 |
| Molecular Formula | C17H23BrN2OSi |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (1S,3aS,8bS)-6-bromo-3-methyl-8b-prop-2-enyl-1-trimethylsilyl-3a,4-dihydro-1H-pyrrolo[2,3-b]indol-2-one |
| SMILES | C=CC[C@]12c3ccc(Br)cc3N[C@H]1N(C)C(=O)[C@H]2[Si](C)(C)C |
| InChI | InChI=1S/C17H23BrN2OSi/c1-6-9-17-12-8-7-11(18)10-13(12)19-16(17)20(2)15(21)14(17)22(3,4)5/h6-8,10,14,16,19H,1,9H2,2-5H3/t14-,16+,17-/m1/s1 |
| InChIKey | PVLIVOKHXQKNRH-HYVNUMGLSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|