C16H30N2O — CID 23625132
(4R,5R)-1,3-ditert-butyl-4-ethenyl-5-propylimidazolidin-2-one (PubChem CID 23625132) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is (4R,5R)-1,3-ditert-butyl-4-ethenyl-5-propylimidazolidin-2-one.
| Compound Name | (4R,5R)-1,3-ditert-butyl-4-ethenyl-5-propylimidazolidin-2-one |
|---|---|
| PubChem CID | 23625132 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | (4R,5R)-1,3-ditert-butyl-4-ethenyl-5-propylimidazolidin-2-one |
| SMILES | C=C[C@@H]1[C@@H](CCC)N(C(C)(C)C)C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C16H30N2O/c1-9-11-13-12(10-2)17(15(3,4)5)14(19)18(13)16(6,7)8/h10,12-13H,2,9,11H2,1,3-8H3/t12-,13-/m1/s1 |
| InChIKey | BHGZABDYBYCPKE-CHWSQXEVSA-N |
| XLogP | 4.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|