C28H42N6O5 — CID 23625391
(2S)-2-[[(2S,3R,4Z)-1-[(2S)-2-benzamido-6-(diaminomethylideneamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 23625391) has the molecular formula C28H42N6O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R,4Z)-1-[(2S)-2-benzamido-6-(diaminomethylideneamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S,3R,4Z)-1-[(2S)-2-benzamido-6-(diaminomethylideneamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23625391 |
| Molecular Formula | C28H42N6O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | (2S)-2-[[(2S,3R,4Z)-1-[(2S)-2-benzamido-6-(diaminomethylideneamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | C/C=C1\CN(C(=O)[C@H](CCCCN=C(N)N)NC(=O)c2ccccc2)[C@H](C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C28H42N6O5/c1-5-19-16-34(23(18(19)4)25(36)33-22(27(38)39)15-17(2)3)26(37)21(13-9-10-14-31-28(29)30)32-24(35)20-11-7-6-8-12-20/h5-8,11-12,17-18,21-23H,9-10,13-16H2,1-4H3,(H,32,35)(H,33,36)(H,38,39)(H4,29,30,31)/b19-5+/t18-,21+,22+,23+/m1/s1 |
| InChIKey | BJWAMDSUOTWAAR-UQFBLIRTSA-N |
| XLogP | 1.64 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|