C22H18O8 — CID 23625550
methyl (1S,4S,8R,10S,11E,14S)-11-[(4-acetyloxyphenyl)methylidene]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate (PubChem CID 23625550) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is methyl (1S,4S,8R,10S,11E,14S)-11-[(4-acetyloxyphenyl)methylidene]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate.
| Compound Name | methyl (1S,4S,8R,10S,11E,14S)-11-[(4-acetyloxyphenyl)methylidene]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate |
|---|---|
| PubChem CID | 23625550 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | methyl (1S,4S,8R,10S,11E,14S)-11-[(4-acetyloxyphenyl)methylidene]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2O[C@H]3/C(=C\c4ccc(OC(C)=O)cc4)C(=O)O[C@]34C=C[C@H]1[C@H]24 |
| InChI | InChI=1S/C22H18O8/c1-11(23)28-13-5-3-12(4-6-13)9-15-18-22(30-20(15)25)8-7-14-16(19(24)26-2)10-27-21(29-18)17(14)22/h3-10,14,17-18,21H,1-2H3/b15-9+/t14-,17-,18+,21-,22+/m1/s1 |
| InChIKey | TXIYCTDKGVURRS-BDRRLFJXSA-N |
| XLogP | 1.91 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|