About 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione
2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione (PubChem CID 23625670) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione.
Molecular Properties
| Compound Name | 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
| PubChem CID | 23625670 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
| SMILES | O=c1cccc2[nH]c(-c3ccccc3)cc(=O)n12 |
| InChI | InChI=1S/C14H10N2O2/c17-13-8-4-7-12-15-11(9-14(18)16(12)13)10-5-2-1-3-6-10/h1-9,15H |
| InChIKey | FJEXOBDOBDJJQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The IUPAC name of 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione (CID 23625670) is 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione.
What is the SMILES notation for 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The canonical SMILES for 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione is O=c1cccc2[nH]c(-c3ccccc3)cc(=O)n12.
What is the InChIKey of 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The InChIKey is FJEXOBDOBDJJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-13-8-4-7-12-15-11(9-14(18)16(12)13)10-5-2-1-3-6-10/h1-9,15H.
What are the key properties of 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione has a molecular weight of 238.25 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-pyrido[1,2-a]pyrimidine-4,6-dione is sourced from PubChem (CID 23625670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).