C21H24O7 — CID 23625707
methyl (1S,5R,7R,10S,11E,14R)-7-methyl-3,9-dioxo-14-prop-1-en-2-yl-4,16,17-trioxatetracyclo[10.3.1.12,5.17,10]octadeca-2(18),11-diene-11-carboxylate (PubChem CID 23625707) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (1S,5R,7R,10S,11E,14R)-7-methyl-3,9-dioxo-14-prop-1-en-2-yl-4,16,17-trioxatetracyclo[10.3.1.12,5.17,10]octadeca-2(18),11-diene-11-carboxylate.
| Compound Name | methyl (1S,5R,7R,10S,11E,14R)-7-methyl-3,9-dioxo-14-prop-1-en-2-yl-4,16,17-trioxatetracyclo[10.3.1.12,5.17,10]octadeca-2(18),11-diene-11-carboxylate |
|---|---|
| PubChem CID | 23625707 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl (1S,5R,7R,10S,11E,14R)-7-methyl-3,9-dioxo-14-prop-1-en-2-yl-4,16,17-trioxatetracyclo[10.3.1.12,5.17,10]octadeca-2(18),11-diene-11-carboxylate |
| SMILES | C=C(C)[C@H]1C/C2=C(\C(=O)OC)[C@@H]3O[C@@](C)(CC3=O)C[C@@H]3C=C(C(=O)O3)[C@H](C1)O2 |
| InChI | InChI=1S/C21H24O7/c1-10(2)11-5-15-13-7-12(26-19(13)23)8-21(3)9-14(22)18(28-21)17(20(24)25-4)16(6-11)27-15/h7,11-12,15,18H,1,5-6,8-9H2,2-4H3/b17-16+/t11-,12+,15+,18-,21-/m1/s1 |
| InChIKey | UNTGQDGFBQQJKZ-SUCYXBIQSA-N |
| XLogP | 2.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|