About 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine
3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine (PubChem CID 23625764) has the molecular formula C18H18FN3O2S
and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine |
| PubChem CID | 23625764 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1cccc(F)c1)c1cn(C2CCCNC2)c2ncccc12 |
| InChI | InChI=1S/C18H18FN3O2S/c19-13-4-1-6-15(10-13)25(23,24)17-12-22(14-5-2-8-20-11-14)18-16(17)7-3-9-21-18/h1,3-4,6-7,9-10,12,14,20H,2,5,8,11H2 |
| InChIKey | DOJKPUAGTKRXCL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine (CID 23625764) is 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine is O=S(=O)(c1cccc(F)c1)c1cn(C2CCCNC2)c2ncccc12.
What is the InChIKey of 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine?
The InChIKey is DOJKPUAGTKRXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN3O2S/c19-13-4-1-6-15(10-13)25(23,24)17-12-22(14-5-2-8-20-11-14)18-16(17)7-3-9-21-18/h1,3-4,6-7,9-10,12,14,20H,2,5,8,11H2.
What are the key properties of 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine?
3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine has a molecular weight of 359.43 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)sulfonyl-1-piperidin-3-ylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 23625764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).