About 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione
2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione (PubChem CID 23625831) has the molecular formula C14H10N2O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
| PubChem CID | 23625831 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
| SMILES | O=c1cccc2[nH]c(-c3ccc(O)cc3)cc(=O)n12 |
| InChI | InChI=1S/C14H10N2O3/c17-10-6-4-9(5-7-10)11-8-14(19)16-12(15-11)2-1-3-13(16)18/h1-8,15,17H |
| InChIKey | OSESDIJCYLNYFQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The IUPAC name of 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione (CID 23625831) is 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione.
What is the SMILES notation for 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The canonical SMILES for 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione is O=c1cccc2[nH]c(-c3ccc(O)cc3)cc(=O)n12.
What is the InChIKey of 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
The InChIKey is OSESDIJCYLNYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c17-10-6-4-9(5-7-10)11-8-14(19)16-12(15-11)2-1-3-13(16)18/h1-8,15,17H.
What are the key properties of 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione?
2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione has a molecular weight of 254.25 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione is sourced from PubChem (CID 23625831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).