C27H28N4O — CID 23626095
1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-1,3,4-benzotriazepin-2-one (PubChem CID 23626095) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23626095 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-(4-aminophenyl)-3-benzyl-5-cyclohexyl-1,3,4-benzotriazepin-2-one |
| SMILES | Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H28N4O/c28-22-15-17-23(18-16-22)31-25-14-8-7-13-24(25)26(21-11-5-2-6-12-21)29-30(27(31)32)19-20-9-3-1-4-10-20/h1,3-4,7-10,13-18,21H,2,5-6,11-12,19,28H2 |
| InChIKey | IXYSVUNLBBCQRQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|