C27H48N2O6 — CID 23626115
(2R,4S,5S,7S)-5-amino-4-hydroxy-N-(4-hydroxybutyl)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide (PubChem CID 23626115) has the molecular formula C27H48N2O6 and a molecular weight of 496.69 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-4-hydroxy-N-(4-hydroxybutyl)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-N-(4-hydroxybutyl)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide |
|---|---|
| PubChem CID | 23626115 |
| Molecular Formula | C27H48N2O6 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-N-(4-hydroxybutyl)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)NCCCCO)C(C)C)ccc1OC |
| InChI | InChI=1S/C27H48N2O6/c1-19(2)22(16-21-9-10-25(34-5)26(17-21)35-14-8-13-33-4)18-23(28)24(31)15-20(3)27(32)29-11-6-7-12-30/h9-10,17,19-20,22-24,30-31H,6-8,11-16,18,28H2,1-5H3,(H,29,32)/t20-,22+,23+,24+/m1/s1 |
| InChIKey | QUBJGXKEBUBAFN-KAMZKSLDSA-N |
| XLogP | 2.92 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|