C29H32N6O — CID 23626241
2-[4-[3-benzyl-5-(cyclohexylmethyl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine (PubChem CID 23626241) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is 2-[4-[3-benzyl-5-(cyclohexylmethyl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine.
| Compound Name | 2-[4-[3-benzyl-5-(cyclohexylmethyl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 23626241 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[4-[3-benzyl-5-(cyclohexylmethyl)-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine |
| SMILES | NC(N)=Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(CC3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H32N6O/c30-28(31)32-23-15-17-24(18-16-23)35-27-14-8-7-13-25(27)26(19-21-9-3-1-4-10-21)33-34(29(35)36)20-22-11-5-2-6-12-22/h2,5-8,11-18,21H,1,3-4,9-10,19-20H2,(H4,30,31,32) |
| InChIKey | WWMSLCULYOVWHB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|