C17H13NO2S2 — CID 2362633
(2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 2362633) has the molecular formula C17H13NO2S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2362633 |
| Molecular Formula | C17H13NO2S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1cccs1)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H13NO2S2/c19-16(9-8-15-7-4-10-21-15)20-11-14-12-22-17(18-14)13-5-2-1-3-6-13/h1-10,12H,11H2/b9-8+ |
| InChIKey | YGBUCNGBBHKBNH-CMDGGOBGSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|