About copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate
copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate (PubChem CID 23626390) has the molecular formula C20H22CuN2O2
and a molecular weight of 385.95 g/mol. Its IUPAC name is copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate.
Molecular Properties
| Compound Name | copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate |
| PubChem CID | 23626390 |
| Molecular Formula | C20H22CuN2O2 |
| Molecular Weight | 385.95 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate |
| SMILES | CC(C)Cc1ccc(C(C)/C([O-])=N/N=C\c2ccccc2[O-])cc1.[Cu+2] |
| InChI | InChI=1S/C20H24N2O2.Cu/c1-14(2)12-16-8-10-17(11-9-16)15(3)20(24)22-21-13-18-6-4-5-7-19(18)23;/h4-11,13-15,23H,12H2,1-3H3,(H,22,24);/q;+2/p-2/b21-13-; |
| InChIKey | GWMOJLPZDIHNTF-GNWMQEPYSA-L |
| XLogP | 2.85 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate?
The IUPAC name of copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate (CID 23626390) is copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate.
What is the SMILES notation for copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate?
The canonical SMILES for copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate is CC(C)Cc1ccc(C(C)/C([O-])=N/N=C\c2ccccc2[O-])cc1.[Cu+2].
What is the InChIKey of copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate?
The InChIKey is GWMOJLPZDIHNTF-GNWMQEPYSA-L. The full InChI is InChI=1S/C20H24N2O2.Cu/c1-14(2)12-16-8-10-17(11-9-16)15(3)20(24)22-21-13-18-6-4-5-7-19(18)23;/h4-11,13-15,23H,12H2,1-3H3,(H,22,24);/q;+2/p-2/b21-13-;.
What are the key properties of copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate?
copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate has a molecular weight of 385.95 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper (NZ,1Z)-2-[4-(2-methylpropyl)phenyl]-N-[(2-oxidophenyl)methylidene]propanehydrazonate is sourced from PubChem (CID 23626390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).