C28H48N2O7 — CID 23626415
ethyl 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoate (PubChem CID 23626415) has the molecular formula C28H48N2O7 and a molecular weight of 524.70 g/mol. Its IUPAC name is ethyl 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoate.
| Compound Name | ethyl 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoate |
|---|---|
| PubChem CID | 23626415 |
| Molecular Formula | C28H48N2O7 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | ethyl 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C28H48N2O7/c1-7-36-27(32)11-12-30-28(33)20(4)15-24(31)23(29)18-22(19(2)3)16-21-9-10-25(35-6)26(17-21)37-14-8-13-34-5/h9-10,17,19-20,22-24,31H,7-8,11-16,18,29H2,1-6H3,(H,30,33)/t20-,22+,23+,24+/m1/s1 |
| InChIKey | CKOOPCQQFYOAEC-KAMZKSLDSA-N |
| XLogP | 3.10 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|