C28H34N6O — CID 23626559
5-cyclohexyl-1-[4-[3-(1H-imidazol-2-yl)propylamino]phenyl]-3,8-dimethyl-1,3,4-benzotriazepin-2-one (PubChem CID 23626559) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is 5-cyclohexyl-1-[4-[3-(1H-imidazol-2-yl)propylamino]phenyl]-3,8-dimethyl-1,3,4-benzotriazepin-2-one.
| Compound Name | 5-cyclohexyl-1-[4-[3-(1H-imidazol-2-yl)propylamino]phenyl]-3,8-dimethyl-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23626559 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 5-cyclohexyl-1-[4-[3-(1H-imidazol-2-yl)propylamino]phenyl]-3,8-dimethyl-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(c1ccc(NCCCc3ncc[nH]3)cc1)C(=O)N(C)N=C2C1CCCCC1 |
| InChI | InChI=1S/C28H34N6O/c1-20-10-15-24-25(19-20)34(28(35)33(2)32-27(24)21-7-4-3-5-8-21)23-13-11-22(12-14-23)29-16-6-9-26-30-17-18-31-26/h10-15,17-19,21,29H,3-9,16H2,1-2H3,(H,30,31) |
| InChIKey | OBNYBKBYBUWFOQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|