About [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate
[3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate (PubChem CID 23626631) has the molecular formula C27H40O4
and a molecular weight of 428.61 g/mol. Its IUPAC name is [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate.
Molecular Properties
| Compound Name | [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate |
| PubChem CID | 23626631 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCc1cc(OC(C)=O)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C27H40O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-20-26(30-23(2)28)22-27(21-25)31-24(3)29/h8-9,11-12,20-22H,4-7,10,13-19H2,1-3H3/b9-8-,12-11- |
| InChIKey | WXVTZFAQKBGMLT-MURFETPASA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate?
The IUPAC name of [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate (CID 23626631) is [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate.
What is the SMILES notation for [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate?
The canonical SMILES for [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate is CCCCC/C=C\C/C=C\CCCCCCCc1cc(OC(C)=O)cc(OC(C)=O)c1.
What is the InChIKey of [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate?
The InChIKey is WXVTZFAQKBGMLT-MURFETPASA-N. The full InChI is InChI=1S/C27H40O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-20-26(30-23(2)28)22-27(21-25)31-24(3)29/h8-9,11-12,20-22H,4-7,10,13-19H2,1-3H3/b9-8-,12-11-.
What are the key properties of [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate?
[3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate has a molecular weight of 428.61 g/mol, XLogP of 7.50, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-5-[(8Z,11Z)-heptadeca-8,11-dienyl]phenyl] acetate is sourced from PubChem (CID 23626631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).