C27H38O4 — CID 23626632
[3-acetyloxy-5-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienyl]phenyl] acetate (PubChem CID 23626632) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is [3-acetyloxy-5-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienyl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienyl]phenyl] acetate |
|---|---|
| PubChem CID | 23626632 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [3-acetyloxy-5-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienyl]phenyl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCc1cc(OC(C)=O)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C27H38O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-20-26(30-23(2)28)22-27(21-25)31-24(3)29/h5-6,8-9,11-12,20-22H,4,7,10,13-19H2,1-3H3/b6-5-,9-8-,12-11- |
| InChIKey | VMEAWLAPCVPRBS-AGRJPVHOSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|