C21H34O3 — CID 23626964
ethyl (2E)-2-[(4aR,4bS,8aS,10aR)-10a-hydroxy-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]acetate (PubChem CID 23626964) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethyl (2E)-2-[(4aR,4bS,8aS,10aR)-10a-hydroxy-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(4aR,4bS,8aS,10aR)-10a-hydroxy-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]acetate |
|---|---|
| PubChem CID | 23626964 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | ethyl (2E)-2-[(4aR,4bS,8aS,10aR)-10a-hydroxy-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC[C@H]2[C@@](O)(CC[C@H]3C(C)(C)CCC[C@@]32C)C1 |
| InChI | InChI=1S/C21H34O3/c1-5-24-18(22)13-15-7-8-17-20(4)11-6-10-19(2,3)16(20)9-12-21(17,23)14-15/h13,16-17,23H,5-12,14H2,1-4H3/b15-13+/t16-,17+,20-,21+/m0/s1 |
| InChIKey | OGZWWKHOWAJYEN-DZFOVHIKSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|