About 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea
1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea (PubChem CID 23627029) has the molecular formula C19H17N5O3S2
and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea |
| PubChem CID | 23627029 |
| Molecular Formula | C19H17N5O3S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)NCc3ncc(-c4ccccc4)[nH]3)sc2c1 |
| InChI | InChI=1S/C19H17N5O3S2/c1-29(26,27)13-7-8-14-16(9-13)28-19(23-14)24-18(25)21-11-17-20-10-15(22-17)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,22)(H2,21,23,24,25) |
| InChIKey | KLRFOLXMDIPPKI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea?
The IUPAC name of 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea (CID 23627029) is 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea.
What is the SMILES notation for 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea?
The canonical SMILES for 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea is CS(=O)(=O)c1ccc2nc(NC(=O)NCc3ncc(-c4ccccc4)[nH]3)sc2c1.
What is the InChIKey of 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea?
The InChIKey is KLRFOLXMDIPPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O3S2/c1-29(26,27)13-7-8-14-16(9-13)28-19(23-14)24-18(25)21-11-17-20-10-15(22-17)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,22)(H2,21,23,24,25).
What are the key properties of 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea?
1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea has a molecular weight of 427.51 g/mol, XLogP of 3.41, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[(5-phenyl-1H-imidazol-2-yl)methyl]urea is sourced from PubChem (CID 23627029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).