C15H20O3 — CID 23627126
2-[(5R,8S,8aS)-5-hydroxy-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydronaphthalen-2-yl]propanal (PubChem CID 23627126) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-[(5R,8S,8aS)-5-hydroxy-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydronaphthalen-2-yl]propanal.
| Compound Name | 2-[(5R,8S,8aS)-5-hydroxy-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydronaphthalen-2-yl]propanal |
|---|---|
| PubChem CID | 23627126 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[(5R,8S,8aS)-5-hydroxy-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydronaphthalen-2-yl]propanal |
| SMILES | CC(C=O)C1=C[C@@]2(C)C(=CC1=O)[C@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C15H20O3/c1-9(8-16)11-7-15(3)10(2)4-5-13(17)12(15)6-14(11)18/h6-10,13,17H,4-5H2,1-3H3/t9?,10-,13+,15+/m0/s1 |
| InChIKey | VPFADTWMSCOYGD-HIQSBDGRSA-N |
| XLogP | 2.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|