C20H18F3NO4S — CID 23627404
2-[2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid (PubChem CID 23627404) has the molecular formula C20H18F3NO4S and a molecular weight of 425.43 g/mol. Its IUPAC name is 2-[2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 23627404 |
| Molecular Formula | C20H18F3NO4S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2ccccc2n1Cc1ccc(S(C)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C20H18F3NO4S/c1-12-16(10-19(25)26)15-5-3-4-6-18(15)24(12)11-13-7-8-14(29(2,27)28)9-17(13)20(21,22)23/h3-9H,10-11H2,1-2H3,(H,25,26) |
| InChIKey | KYXARNZCIFRLKE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|