C28H27F2N3O4 — CID 23627613
4-[4-[(2,6-difluorophenyl)methyl]piperazin-1-yl]-2-[(3,4-dimethoxyphenyl)methyl]isoindole-1,3-dione (PubChem CID 23627613) has the molecular formula C28H27F2N3O4 and a molecular weight of 507.54 g/mol. Its IUPAC name is 4-[4-[(2,6-difluorophenyl)methyl]piperazin-1-yl]-2-[(3,4-dimethoxyphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[(2,6-difluorophenyl)methyl]piperazin-1-yl]-2-[(3,4-dimethoxyphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23627613 |
| Molecular Formula | C28H27F2N3O4 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 4-[4-[(2,6-difluorophenyl)methyl]piperazin-1-yl]-2-[(3,4-dimethoxyphenyl)methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccc(N4CCN(Cc5c(F)cccc5F)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C28H27F2N3O4/c1-36-24-10-9-18(15-25(24)37-2)16-33-27(34)19-5-3-8-23(26(19)28(33)35)32-13-11-31(12-14-32)17-20-21(29)6-4-7-22(20)30/h3-10,15H,11-14,16-17H2,1-2H3 |
| InChIKey | WPRDJOXSKKQDNA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|