C37H41N5O6S — CID 23627781
N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]pyridine-3-sulfonamide (PubChem CID 23627781) has the molecular formula C37H41N5O6S and a molecular weight of 683.83 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]pyridine-3-sulfonamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 23627781 |
| Molecular Formula | C37H41N5O6S |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]pyridine-3-sulfonamide |
| SMILES | COc1ccc(C(CCCNS(=O)(=O)c2cccnc2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H41N5O6S/c1-26(27-10-5-4-6-11-27)40-20-22-41(23-21-40)32-14-7-13-30-35(32)37(44)42(36(30)43)31(28-16-17-33(47-2)34(24-28)48-3)15-9-19-39-49(45,46)29-12-8-18-38-25-29/h4-8,10-14,16-18,24-26,31,39H,9,15,19-23H2,1-3H3/t26-,31?/m1/s1 |
| InChIKey | DFYGRKWVSSSDAU-SYQKMTEESA-N |
| XLogP | 5.08 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|