C30H42O12 — CID 23627793
1,7,8-trihydroxy-5,14,14,17-tetramethyl-15,16-bis(2-methylbutanoyloxy)-6-oxo-4,10-dioxahexacyclo[10.5.0.02,7.03,5.09,11.013,15]heptadecane-9-carboxylic acid (PubChem CID 23627793) has the molecular formula C30H42O12 and a molecular weight of 594.65 g/mol. Its IUPAC name is 1,7,8-trihydroxy-5,14,14,17-tetramethyl-15,16-bis(2-methylbutanoyloxy)-6-oxo-4,10-dioxahexacyclo[10.5.0.02,7.03,5.09,11.013,15]heptadecane-9-carboxylic acid.
| Compound Name | 1,7,8-trihydroxy-5,14,14,17-tetramethyl-15,16-bis(2-methylbutanoyloxy)-6-oxo-4,10-dioxahexacyclo[10.5.0.02,7.03,5.09,11.013,15]heptadecane-9-carboxylic acid |
|---|---|
| PubChem CID | 23627793 |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 1,7,8-trihydroxy-5,14,14,17-tetramethyl-15,16-bis(2-methylbutanoyloxy)-6-oxo-4,10-dioxahexacyclo[10.5.0.02,7.03,5.09,11.013,15]heptadecane-9-carboxylic acid |
| SMILES | CCC(C)C(=O)OC1C(C)C2(O)C(C3OC3(C(=O)O)C(O)C3(O)C(=O)C4(C)OC4C32)C2C(C)(C)C12OC(=O)C(C)CC |
| InChI | InChI=1S/C30H42O12/c1-9-11(3)20(31)39-17-13(5)27(37)14(15-25(6,7)30(15,17)42-21(32)12(4)10-2)18-29(41-18,24(35)36)23(34)28(38)16(27)19-26(8,40-19)22(28)33/h11-19,23,34,37-38H,9-10H2,1-8H3,(H,35,36) |
| InChIKey | AHOSVTVMEMNFRC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 192.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|